C21H19N2O+ — CID 132507469
8-(4-methoxyphenyl)-1-methyl-7-phenylimidazo[1,2-a]pyridin-1-ium (PubChem CID 132507469) has the molecular formula C21H19N2O+ and a molecular weight of 315.40 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-1-methyl-7-phenylimidazo[1,2-a]pyridin-1-ium.
| Compound Name | 8-(4-methoxyphenyl)-1-methyl-7-phenylimidazo[1,2-a]pyridin-1-ium |
|---|---|
| PubChem CID | 132507469 |
| Molecular Formula | C21H19N2O+ |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 8-(4-methoxyphenyl)-1-methyl-7-phenylimidazo[1,2-a]pyridin-1-ium |
| SMILES | COc1ccc(-c2c(-c3ccccc3)ccn3cc[n+](C)c23)cc1 |
| InChI | InChI=1S/C21H19N2O/c1-22-14-15-23-13-12-19(16-6-4-3-5-7-16)20(21(22)23)17-8-10-18(24-2)11-9-17/h3-15H,1-2H3/q+1 |
| InChIKey | ZYGNHEYGXDLCAO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|