C20H16N3O2+ — CID 132507468
1-methyl-8-(4-nitrophenyl)-7-phenylimidazo[1,2-a]pyridin-1-ium (PubChem CID 132507468) has the molecular formula C20H16N3O2+ and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-methyl-8-(4-nitrophenyl)-7-phenylimidazo[1,2-a]pyridin-1-ium.
| Compound Name | 1-methyl-8-(4-nitrophenyl)-7-phenylimidazo[1,2-a]pyridin-1-ium |
|---|---|
| PubChem CID | 132507468 |
| Molecular Formula | C20H16N3O2+ |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-methyl-8-(4-nitrophenyl)-7-phenylimidazo[1,2-a]pyridin-1-ium |
| SMILES | C[n+]1ccn2ccc(-c3ccccc3)c(-c3ccc([N+](=O)[O-])cc3)c21 |
| InChI | InChI=1S/C20H16N3O2/c1-21-13-14-22-12-11-18(15-5-3-2-4-6-15)19(20(21)22)16-7-9-17(10-8-16)23(24)25/h2-14H,1H3/q+1 |
| InChIKey | RHGTWJLBNWEEDI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|