C24H18N4O4 — CID 174929403
6-(4-aminophenyl)-2,3-bis(4-nitrophenyl)aniline (PubChem CID 174929403) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 6-(4-aminophenyl)-2,3-bis(4-nitrophenyl)aniline.
| Compound Name | 6-(4-aminophenyl)-2,3-bis(4-nitrophenyl)aniline |
|---|---|
| PubChem CID | 174929403 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 6-(4-aminophenyl)-2,3-bis(4-nitrophenyl)aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)c2N)cc1 |
| InChI | InChI=1S/C24H18N4O4/c25-18-7-1-16(2-8-18)22-14-13-21(15-3-9-19(10-4-15)27(29)30)23(24(22)26)17-5-11-20(12-6-17)28(31)32/h1-14H,25-26H2 |
| InChIKey | BSQQELPWIBVQAX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|