C20H12N2O4 — CID 174815967
1-amino-2-(4-nitrophenyl)anthracene-9,10-dione (PubChem CID 174815967) has the molecular formula C20H12N2O4 and a molecular weight of 344.33 g/mol. Its IUPAC name is 1-amino-2-(4-nitrophenyl)anthracene-9,10-dione.
| Compound Name | 1-amino-2-(4-nitrophenyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 174815967 |
| Molecular Formula | C20H12N2O4 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-amino-2-(4-nitrophenyl)anthracene-9,10-dione |
| SMILES | Nc1c(-c2ccc([N+](=O)[O-])cc2)ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H12N2O4/c21-18-13(11-5-7-12(8-6-11)22(25)26)9-10-16-17(18)20(24)15-4-2-1-3-14(15)19(16)23/h1-10H,21H2 |
| InChIKey | IXUHLZJYQFUERU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|