C17H10N4O3 — CID 127028908
2-amino-4-(4-nitrophenyl)indeno[1,2-d]pyrimidin-5-one (PubChem CID 127028908) has the molecular formula C17H10N4O3 and a molecular weight of 318.29 g/mol. Its IUPAC name is 2-amino-4-(4-nitrophenyl)indeno[1,2-d]pyrimidin-5-one.
| Compound Name | 2-amino-4-(4-nitrophenyl)indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 127028908 |
| Molecular Formula | C17H10N4O3 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-amino-4-(4-nitrophenyl)indeno[1,2-d]pyrimidin-5-one |
| SMILES | Nc1nc(-c2ccc([N+](=O)[O-])cc2)c2c(n1)-c1ccccc1C2=O |
| InChI | InChI=1S/C17H10N4O3/c18-17-19-14(9-5-7-10(8-6-9)21(23)24)13-15(20-17)11-3-1-2-4-12(11)16(13)22/h1-8H,(H2,18,19,20) |
| InChIKey | RNVTWWDCJHGABR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|