C35H23N2O2P — CID 118372598
4-(4-diphenylphosphorylphenyl)-2-phenylindeno[1,2-d]pyrimidin-5-one (PubChem CID 118372598) has the molecular formula C35H23N2O2P and a molecular weight of 534.56 g/mol. Its IUPAC name is 4-(4-diphenylphosphorylphenyl)-2-phenylindeno[1,2-d]pyrimidin-5-one.
| Compound Name | 4-(4-diphenylphosphorylphenyl)-2-phenylindeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118372598 |
| Molecular Formula | C35H23N2O2P |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 4-(4-diphenylphosphorylphenyl)-2-phenylindeno[1,2-d]pyrimidin-5-one |
| SMILES | O=C1c2ccccc2-c2nc(-c3ccccc3)nc(-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)c21 |
| InChI | InChI=1S/C35H23N2O2P/c38-34-30-19-11-10-18-29(30)33-31(34)32(36-35(37-33)25-12-4-1-5-13-25)24-20-22-28(23-21-24)40(39,26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-23H |
| InChIKey | AHALVNMPOACFCA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|