C21H13N5O6 — CID 4540474
1-amino-2-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]anthracene-9,10-dione (PubChem CID 4540474) has the molecular formula C21H13N5O6 and a molecular weight of 431.36 g/mol. Its IUPAC name is 1-amino-2-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]anthracene-9,10-dione.
| Compound Name | 1-amino-2-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 4540474 |
| Molecular Formula | C21H13N5O6 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 1-amino-2-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]anthracene-9,10-dione |
| SMILES | Nc1c(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H13N5O6/c22-19-11(10-23-24-16-8-6-12(25(29)30)9-17(16)26(31)32)5-7-15-18(19)21(28)14-4-2-1-3-13(14)20(15)27/h1-10,24H,22H2 |
| InChIKey | UMXQQWDYTIYFBP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 170.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|