C38H28N2O2 — CID 174747150
4-[2-(4-nitrophenyl)-4-(1,2,2-triphenylethenyl)phenyl]aniline (PubChem CID 174747150) has the molecular formula C38H28N2O2 and a molecular weight of 544.65 g/mol. Its IUPAC name is 4-[2-(4-nitrophenyl)-4-(1,2,2-triphenylethenyl)phenyl]aniline.
| Compound Name | 4-[2-(4-nitrophenyl)-4-(1,2,2-triphenylethenyl)phenyl]aniline |
|---|---|
| PubChem CID | 174747150 |
| Molecular Formula | C38H28N2O2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 4-[2-(4-nitrophenyl)-4-(1,2,2-triphenylethenyl)phenyl]aniline |
| SMILES | Nc1ccc(-c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C38H28N2O2/c39-33-21-16-27(17-22-33)35-25-20-32(26-36(35)28-18-23-34(24-19-28)40(41)42)38(31-14-8-3-9-15-31)37(29-10-4-1-5-11-29)30-12-6-2-7-13-30/h1-26H,39H2 |
| InChIKey | MLCFLMIAGZKDAH-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|