C31H24N4O3 — CID 141325798
N,N-bis[4-(4-aminophenyl)phenyl]-4-nitrobenzamide (PubChem CID 141325798) has the molecular formula C31H24N4O3 and a molecular weight of 500.56 g/mol. Its IUPAC name is N,N-bis[4-(4-aminophenyl)phenyl]-4-nitrobenzamide.
| Compound Name | N,N-bis[4-(4-aminophenyl)phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 141325798 |
| Molecular Formula | C31H24N4O3 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N,N-bis[4-(4-aminophenyl)phenyl]-4-nitrobenzamide |
| SMILES | Nc1ccc(-c2ccc(N(C(=O)c3ccc([N+](=O)[O-])cc3)c3ccc(-c4ccc(N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H24N4O3/c32-26-11-1-21(2-12-26)23-5-15-28(16-6-23)34(31(36)25-9-19-30(20-10-25)35(37)38)29-17-7-24(8-18-29)22-3-13-27(33)14-4-22/h1-20H,32-33H2 |
| InChIKey | WNEWKQPKKXODSF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|