C32H23BrClNO4S — CID 10746606
2-[4-(4-bromophenyl)-2,6-diphenylphenyl]-3-methyl-1,3-benzothiazol-3-ium perchlorate (PubChem CID 10746606) has the molecular formula C32H23BrClNO4S and a molecular weight of 632.96 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)-2,6-diphenylphenyl]-3-methyl-1,3-benzothiazol-3-ium perchlorate.
| Compound Name | 2-[4-(4-bromophenyl)-2,6-diphenylphenyl]-3-methyl-1,3-benzothiazol-3-ium perchlorate |
|---|---|
| PubChem CID | 10746606 |
| Molecular Formula | C32H23BrClNO4S |
| Molecular Weight | 632.96 g/mol |
| Exact Mass | 631.02 |
| IUPAC Name | 2-[4-(4-bromophenyl)-2,6-diphenylphenyl]-3-methyl-1,3-benzothiazol-3-ium perchlorate |
| SMILES | C[n+]1c(-c2c(-c3ccccc3)cc(-c3ccc(Br)cc3)cc2-c2ccccc2)sc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C32H23BrNS.ClHO4/c1-34-29-14-8-9-15-30(29)35-32(34)31-27(23-10-4-2-5-11-23)20-25(22-16-18-26(33)19-17-22)21-28(31)24-12-6-3-7-13-24;2-1(3,4)5/h2-21H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | SKMIFASDHFKWKX-UHFFFAOYSA-M |
| XLogP | 4.40 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.96 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|