C35H28ClNO4 — CID 10347827
1-methyl-2-[4-(4-methylphenyl)-2,6-diphenylphenyl]quinolin-1-ium perchlorate (PubChem CID 10347827) has the molecular formula C35H28ClNO4 and a molecular weight of 562.07 g/mol. Its IUPAC name is 1-methyl-2-[4-(4-methylphenyl)-2,6-diphenylphenyl]quinolin-1-ium perchlorate.
| Compound Name | 1-methyl-2-[4-(4-methylphenyl)-2,6-diphenylphenyl]quinolin-1-ium perchlorate |
|---|---|
| PubChem CID | 10347827 |
| Molecular Formula | C35H28ClNO4 |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 1-methyl-2-[4-(4-methylphenyl)-2,6-diphenylphenyl]quinolin-1-ium perchlorate |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)c(-c3ccc4ccccc4[n+]3C)c(-c3ccccc3)c2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C35H28N.ClHO4/c1-25-17-19-26(20-18-25)30-23-31(27-11-5-3-6-12-27)35(32(24-30)28-13-7-4-8-14-28)34-22-21-29-15-9-10-16-33(29)36(34)2;2-1(3,4)5/h3-24H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | IMOCASGSWSJCCW-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|