C25H17BrNO2S+ — CID 25128313
6-bromo-4-[(E)-2-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]ethenyl]chromen-2-one (PubChem CID 25128313) has the molecular formula C25H17BrNO2S+ and a molecular weight of 475.39 g/mol. Its IUPAC name is 6-bromo-4-[(E)-2-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]ethenyl]chromen-2-one.
| Compound Name | 6-bromo-4-[(E)-2-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]ethenyl]chromen-2-one |
|---|---|
| PubChem CID | 25128313 |
| Molecular Formula | C25H17BrNO2S+ |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 6-bromo-4-[(E)-2-[4-(3-methyl-1,3-benzothiazol-3-ium-2-yl)phenyl]ethenyl]chromen-2-one |
| SMILES | C[n+]1c(-c2ccc(/C=C/c3cc(=O)oc4ccc(Br)cc34)cc2)sc2ccccc21 |
| InChI | InChI=1S/C25H17BrNO2S/c1-27-21-4-2-3-5-23(21)30-25(27)17-9-6-16(7-10-17)8-11-18-14-24(28)29-22-13-12-19(26)15-20(18)22/h2-15H,1H3/q+1/b11-8+ |
| InChIKey | ZYGZIUPEVPVWJA-DHZHZOJOSA-N |
| XLogP | 6.43 |
| TPSA | 34.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|