C25H20BClF4S2 — CID 134911244
6-(4-chlorophenyl)-2-ethylsulfanyl-3,4-diphenylthiopyrylium tetrafluoroborate (PubChem CID 134911244) has the molecular formula C25H20BClF4S2 and a molecular weight of 506.83 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-ethylsulfanyl-3,4-diphenylthiopyrylium tetrafluoroborate.
| Compound Name | 6-(4-chlorophenyl)-2-ethylsulfanyl-3,4-diphenylthiopyrylium tetrafluoroborate |
|---|---|
| PubChem CID | 134911244 |
| Molecular Formula | C25H20BClF4S2 |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 6-(4-chlorophenyl)-2-ethylsulfanyl-3,4-diphenylthiopyrylium tetrafluoroborate |
| SMILES | CCSc1[s+]c(-c2ccc(Cl)cc2)cc(-c2ccccc2)c1-c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C25H20ClS2.BF4/c1-2-27-25-24(20-11-7-4-8-12-20)22(18-9-5-3-6-10-18)17-23(28-25)19-13-15-21(26)16-14-19;2-1(3,4)5/h3-17H,2H2,1H3;/q+1;-1 |
| InChIKey | VXRBYLWTGDYICW-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|