C24H19S+ — CID 10836168
4-(4-methylphenyl)-2,6-diphenylthiopyrylium (PubChem CID 10836168) has the molecular formula C24H19S+ and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2,6-diphenylthiopyrylium.
| Compound Name | 4-(4-methylphenyl)-2,6-diphenylthiopyrylium |
|---|---|
| PubChem CID | 10836168 |
| Molecular Formula | C24H19S+ |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-(4-methylphenyl)-2,6-diphenylthiopyrylium |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)[s+]c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H19S/c1-18-12-14-19(15-13-18)22-16-23(20-8-4-2-5-9-20)25-24(17-22)21-10-6-3-7-11-21/h2-17H,1H3/q+1 |
| InChIKey | OKNOXOPXDDNFSD-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|