About bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane
bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane (PubChem CID 88603937) has the molecular formula C50H42BFO6S2
and a molecular weight of 832.82 g/mol. Its IUPAC name is bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane.
Molecular Properties
| Compound Name | bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane |
| PubChem CID | 88603937 |
| Molecular Formula | C50H42BFO6S2 |
| Molecular Weight | 832.82 g/mol |
| Exact Mass | 832.25 |
| IUPAC Name | bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(OC)cc3)[s+]2)cc1.COc1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(OC)cc3)[s+]2)cc1.[O-]B([O-])F |
| InChI | InChI=1S/2C25H21O2S.BFO2/c2*1-26-22-12-8-19(9-13-22)24-16-21(18-6-4-3-5-7-18)17-25(28-24)20-10-14-23(27-2)15-11-20;2-1(3)4/h2*3-17H,1-2H3;/q2*+1;-2 |
| InChIKey | LNKPDCMUOJJSFQ-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 832.82 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane?
The IUPAC name of bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane (CID 88603937) is bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane.
What is the SMILES notation for bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane?
The canonical SMILES for bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane is COc1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(OC)cc3)[s+]2)cc1.COc1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(OC)cc3)[s+]2)cc1.[O-]B([O-])F.
What is the InChIKey of bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane?
The InChIKey is LNKPDCMUOJJSFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C25H21O2S.BFO2/c2*1-26-22-12-8-19(9-13-22)24-16-21(18-6-4-3-5-7-18)17-25(28-24)20-10-14-23(27-2)15-11-20;2-1(3)4/h2*3-17H,1-2H3;/q2*+1;-2.
What are the key properties of bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane?
bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane has a molecular weight of 832.82 g/mol, XLogP of 11.76, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,6-bis(4-methoxyphenyl)-4-phenylthiopyrylium);fluoro(dioxido)borane is sourced from PubChem (CID 88603937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).