C32H35O3S+ — CID 159437746
2,6-bis(4-butoxyphenyl)-4-(4-methoxyphenyl)thiopyrylium (PubChem CID 159437746) has the molecular formula C32H35O3S+ and a molecular weight of 499.70 g/mol. Its IUPAC name is 2,6-bis(4-butoxyphenyl)-4-(4-methoxyphenyl)thiopyrylium.
| Compound Name | 2,6-bis(4-butoxyphenyl)-4-(4-methoxyphenyl)thiopyrylium |
|---|---|
| PubChem CID | 159437746 |
| Molecular Formula | C32H35O3S+ |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2,6-bis(4-butoxyphenyl)-4-(4-methoxyphenyl)thiopyrylium |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccc(OC)cc3)cc(-c3ccc(OCCCC)cc3)[s+]2)cc1 |
| InChI | InChI=1S/C32H35O3S/c1-4-6-20-34-29-16-10-25(11-17-29)31-22-27(24-8-14-28(33-3)15-9-24)23-32(36-31)26-12-18-30(19-13-26)35-21-7-5-2/h8-19,22-23H,4-7,20-21H2,1-3H3/q+1 |
| InChIKey | LRUCZPKIWUPEOT-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|