C64H70BFO4S2 — CID 88713731
bis(2,6-bis(4-ethylphenyl)-4-(4-pentoxyphenyl)thiopyrylium);fluoro(dioxido)borane (PubChem CID 88713731) has the molecular formula C64H70BFO4S2 and a molecular weight of 997.20 g/mol. Its IUPAC name is bis(2,6-bis(4-ethylphenyl)-4-(4-pentoxyphenyl)thiopyrylium);fluoro(dioxido)borane.
| Compound Name | bis(2,6-bis(4-ethylphenyl)-4-(4-pentoxyphenyl)thiopyrylium);fluoro(dioxido)borane |
|---|---|
| PubChem CID | 88713731 |
| Molecular Formula | C64H70BFO4S2 |
| Molecular Weight | 997.20 g/mol |
| Exact Mass | 996.48 |
| IUPAC Name | bis(2,6-bis(4-ethylphenyl)-4-(4-pentoxyphenyl)thiopyrylium);fluoro(dioxido)borane |
| SMILES | CCCCCOc1ccc(-c2cc(-c3ccc(CC)cc3)[s+]c(-c3ccc(CC)cc3)c2)cc1.CCCCCOc1ccc(-c2cc(-c3ccc(CC)cc3)[s+]c(-c3ccc(CC)cc3)c2)cc1.[O-]B([O-])F |
| InChI | InChI=1S/2C32H35OS.BFO2/c2*1-4-7-8-21-33-30-19-17-26(18-20-30)29-22-31(27-13-9-24(5-2)10-14-27)34-32(23-29)28-15-11-25(6-3)12-16-28;2-1(3)4/h2*9-20,22-23H,4-8,21H2,1-3H3;/q2*+1;-2 |
| InChIKey | FTKDWWVBCBQGDQ-UHFFFAOYSA-N |
| XLogP | 17.11 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.20 |
| LogP ≤ 5 | 17.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|