C26H21OS+ — CID 136884128
4-[(E)-2-(4-methoxyphenyl)ethenyl]-2,6-diphenylthiopyrylium (PubChem CID 136884128) has the molecular formula C26H21OS+ and a molecular weight of 381.52 g/mol. Its IUPAC name is 4-[(E)-2-(4-methoxyphenyl)ethenyl]-2,6-diphenylthiopyrylium.
| Compound Name | 4-[(E)-2-(4-methoxyphenyl)ethenyl]-2,6-diphenylthiopyrylium |
|---|---|
| PubChem CID | 136884128 |
| Molecular Formula | C26H21OS+ |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-[(E)-2-(4-methoxyphenyl)ethenyl]-2,6-diphenylthiopyrylium |
| SMILES | COc1ccc(/C=C/c2cc(-c3ccccc3)[s+]c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C26H21OS/c1-27-24-16-14-20(15-17-24)12-13-21-18-25(22-8-4-2-5-9-22)28-26(19-21)23-10-6-3-7-11-23/h2-19H,1H3/q+1/b13-12+ |
| InChIKey | NXUXMIRKLDFJGW-OUKQBFOZSA-N |
| XLogP | 7.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|