C41H29S+ — CID 177440907
2,4,6-tris(4-phenylphenyl)thiopyrylium (PubChem CID 177440907) has the molecular formula C41H29S+ and a molecular weight of 553.75 g/mol. Its IUPAC name is 2,4,6-tris(4-phenylphenyl)thiopyrylium.
| Compound Name | 2,4,6-tris(4-phenylphenyl)thiopyrylium |
|---|---|
| PubChem CID | 177440907 |
| Molecular Formula | C41H29S+ |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | 2,4,6-tris(4-phenylphenyl)thiopyrylium |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccccc5)cc4)[s+]c(-c4ccc(-c5ccccc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C41H29S/c1-4-10-30(11-5-1)33-16-18-36(19-17-33)39-28-40(37-24-20-34(21-25-37)31-12-6-2-7-13-31)42-41(29-39)38-26-22-35(23-27-38)32-14-8-3-9-15-32/h1-29H/q+1 |
| InChIKey | VVJXSXYZJCZTHP-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|