C31H27N2O2S+ — CID 154722258
N,4-dimethyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide (PubChem CID 154722258) has the molecular formula C31H27N2O2S+ and a molecular weight of 491.64 g/mol. Its IUPAC name is N,4-dimethyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154722258 |
| Molecular Formula | C31H27N2O2S+ |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | N,4-dimethyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27N2O2S/c1-24-18-20-29(21-19-24)36(34,35)32(2)33-30(26-14-8-4-9-15-26)22-28(25-12-6-3-7-13-25)23-31(33)27-16-10-5-11-17-27/h3-23H,1-2H3/q+1 |
| InChIKey | CJJKRESCRIPNGW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 41.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|