C28H21BF4N2 — CID 13016817
1,2,4-triphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate (PubChem CID 13016817) has the molecular formula C28H21BF4N2 and a molecular weight of 472.29 g/mol. Its IUPAC name is 1,2,4-triphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate.
| Compound Name | 1,2,4-triphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 13016817 |
| Molecular Formula | C28H21BF4N2 |
| Molecular Weight | 472.29 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1,2,4-triphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(-c2cc(-c3ccccc3)[n+](-c3ccccc3)c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C28H21N2.BF4/c1-4-12-22(13-5-1)24-20-27(23-14-6-2-7-15-23)30(25-16-8-3-9-17-25)28(21-24)26-18-10-11-19-29-26;2-1(3,4)5/h1-21H;/q+1;-1 |
| InChIKey | IVTBLTWUYXXUGB-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.29 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|