C29H23BF4N2 — CID 13016807
1-benzyl-2,4-diphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate (PubChem CID 13016807) has the molecular formula C29H23BF4N2 and a molecular weight of 486.32 g/mol. Its IUPAC name is 1-benzyl-2,4-diphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate.
| Compound Name | 1-benzyl-2,4-diphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 13016807 |
| Molecular Formula | C29H23BF4N2 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-benzyl-2,4-diphenyl-6-pyridin-2-ylpyridin-1-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(C[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccn2)cc1 |
| InChI | InChI=1S/C29H23N2.BF4/c1-4-12-23(13-5-1)22-31-28(25-16-8-3-9-17-25)20-26(24-14-6-2-7-15-24)21-29(31)27-18-10-11-19-30-27;2-1(3,4)5/h1-21H,22H2;/q+1;-1 |
| InChIKey | XBRILRXORLRPFD-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|