C20H21ClN4O6S — CID 10838457
2-[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate (PubChem CID 10838457) has the molecular formula C20H21ClN4O6S and a molecular weight of 480.93 g/mol. Its IUPAC name is 2-[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate.
| Compound Name | 2-[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate |
|---|---|
| PubChem CID | 10838457 |
| Molecular Formula | C20H21ClN4O6S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2-[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylguanidine perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1-c1ccc(S(=O)(=O)N=C(N)N)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C20H21N4O2S.ClHO4/c1-14-12-17(16-6-4-3-5-7-16)13-15(2)24(14)18-8-10-19(11-9-18)27(25,26)23-20(21)22;2-1(3,4)5/h3-13H,1-2H3,(H4,21,22,23);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QZTFFJUMSHUWBO-UHFFFAOYSA-M |
| XLogP | -2.55 |
| TPSA | 194.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|