C21H19N5O4S3 — CID 10436088
[5-[[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfonylazanide (PubChem CID 10436088) has the molecular formula C21H19N5O4S3 and a molecular weight of 501.62 g/mol. Its IUPAC name is [5-[[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfonylazanide.
| Compound Name | [5-[[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfonylazanide |
|---|---|
| PubChem CID | 10436088 |
| Molecular Formula | C21H19N5O4S3 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | [5-[[4-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazol-2-yl]sulfonylazanide |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1-c1ccc(S(=O)(=O)Nc2nnc(S([NH-])(=O)=O)s2)cc1 |
| InChI | InChI=1S/C21H19N5O4S3/c1-14-12-17(16-6-4-3-5-7-16)13-15(2)26(14)18-8-10-19(11-9-18)33(29,30)25-20-23-24-21(31-20)32(22,27)28/h3-13H,1-2H3,(H2-,22,23,25,27,28) |
| InChIKey | YAOLRNODGHQRJE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 133.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|