C23H24ClN5O7S3 — CID 24996180
5-[[4-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide chlorate (PubChem CID 24996180) has the molecular formula C23H24ClN5O7S3 and a molecular weight of 614.13 g/mol. Its IUPAC name is 5-[[4-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide chlorate.
| Compound Name | 5-[[4-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide chlorate |
|---|---|
| PubChem CID | 24996180 |
| Molecular Formula | C23H24ClN5O7S3 |
| Molecular Weight | 614.13 g/mol |
| Exact Mass | 613.05 |
| IUPAC Name | 5-[[4-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide chlorate |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1-c1ccc(S(=O)(=O)Nc2nnc(S(N)(=O)=O)s2)cc1.[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/C23H24N5O4S3.ClO3/c1-3-18-14-17(16-8-6-5-7-9-16)15-19(4-2)28(18)20-10-12-21(13-11-20)35(31,32)27-22-25-26-23(33-22)34(24,29)30;2-1(3)4/h5-15H,3-4H2,1-2H3,(H,25,27)(H2,24,29,30);/q+1;-1 |
| InChIKey | DEKNPUKFPYHYST-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 205.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.13 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|