C23H23N6O5S3+ — CID 10580195
2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]acetamide (PubChem CID 10580195) has the molecular formula C23H23N6O5S3+ and a molecular weight of 559.68 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 10580195 |
| Molecular Formula | C23H23N6O5S3+ |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-[4-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]acetamide |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)Nc1ccc(S(=O)(=O)Nc2nnc(S(N)(=O)=O)s2)cc1 |
| InChI | InChI=1S/C23H22N6O5S3/c1-15-12-18(17-6-4-3-5-7-17)13-16(2)29(15)14-21(30)25-19-8-10-20(11-9-19)37(33,34)28-22-26-27-23(35-22)36(24,31)32/h3-13H,14H2,1-2H3,(H3-,24,25,26,28,30,31,32)/p+1 |
| InChIKey | MCVLNFJGPXSLJD-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 165.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|