C21H23N4O3S+ — CID 10673298
4-[2-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetyl]hydrazinyl]benzenesulfonamide (PubChem CID 10673298) has the molecular formula C21H23N4O3S+ and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[2-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetyl]hydrazinyl]benzenesulfonamide.
| Compound Name | 4-[2-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetyl]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10673298 |
| Molecular Formula | C21H23N4O3S+ |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[2-[2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)acetyl]hydrazinyl]benzenesulfonamide |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)NNc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-15-12-18(17-6-4-3-5-7-17)13-16(2)25(15)14-21(26)24-23-19-8-10-20(11-9-19)29(22,27)28/h3-13,23H,14H2,1-2H3,(H2-,22,24,26,27,28)/p+1 |
| InChIKey | QNSXGUYUNRFMRT-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|