C26H31ClN2O8S — CID 10698231
(4-sulfamoylphenyl)methyl 2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetate perchlorate (PubChem CID 10698231) has the molecular formula C26H31ClN2O8S and a molecular weight of 567.06 g/mol. Its IUPAC name is (4-sulfamoylphenyl)methyl 2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetate perchlorate.
| Compound Name | (4-sulfamoylphenyl)methyl 2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetate perchlorate |
|---|---|
| PubChem CID | 10698231 |
| Molecular Formula | C26H31ClN2O8S |
| Molecular Weight | 567.06 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | (4-sulfamoylphenyl)methyl 2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]acetate perchlorate |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1CC(=O)OCc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H31N2O4S.ClHO4/c1-18(2)24-14-22(21-8-6-5-7-9-21)15-25(19(3)4)28(24)16-26(29)32-17-20-10-12-23(13-11-20)33(27,30)31;2-1(3,4)5/h5-15,18-19H,16-17H2,1-4H3,(H2,27,30,31);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | GYXQWJFNXPWKOB-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.06 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|