C24H29ClN2O6S — CID 10577600
4-[[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]methyl]benzenesulfonamide perchlorate (PubChem CID 10577600) has the molecular formula C24H29ClN2O6S and a molecular weight of 509.02 g/mol. Its IUPAC name is 4-[[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]methyl]benzenesulfonamide perchlorate.
| Compound Name | 4-[[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]methyl]benzenesulfonamide perchlorate |
|---|---|
| PubChem CID | 10577600 |
| Molecular Formula | C24H29ClN2O6S |
| Molecular Weight | 509.02 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 4-[[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]methyl]benzenesulfonamide perchlorate |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1Cc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H29N2O2S.ClHO4/c1-17(2)23-14-21(20-8-6-5-7-9-20)15-24(18(3)4)26(23)16-19-10-12-22(13-11-19)29(25,27)28;2-1(3,4)5/h5-15,17-18H,16H2,1-4H3,(H2,25,27,28);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | HEMYOQBEIRZBJR-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.02 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|