C23H26N3O3S+ — CID 10649727
2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 10649727) has the molecular formula C23H26N3O3S+ and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 10649727 |
| Molecular Formula | C23H26N3O3S+ |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1CC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-3-20-14-18(17-8-6-5-7-9-17)15-21(4-2)26(20)16-23(27)25-19-10-12-22(13-11-19)30(24,28)29/h5-15H,3-4,16H2,1-2H3,(H2-,24,25,27,28,29)/p+1 |
| InChIKey | LHFAXEAZYWUZOF-UHFFFAOYSA-O |
| XLogP | 3.05 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|