C27H34N5O3S+ — CID 10793799
N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)propanamide (PubChem CID 10793799) has the molecular formula C27H34N5O3S+ and a molecular weight of 508.67 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)propanamide.
| Compound Name | N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 10793799 |
| Molecular Formula | C27H34N5O3S+ |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(4-phenyl-2,6-dipropylpyridin-1-ium-1-yl)propanamide |
| SMILES | CCCc1cc(-c2ccccc2)cc(CCC)[n+]1CCC(=O)Nc1ccc(S(=O)(=O)N=C(N)N)cc1 |
| InChI | InChI=1S/C27H33N5O3S/c1-3-8-23-18-21(20-10-6-5-7-11-20)19-24(9-4-2)32(23)17-16-26(33)30-22-12-14-25(15-13-22)36(34,35)31-27(28)29/h5-7,10-15,18-19H,3-4,8-9,16-17H2,1-2H3,(H4-,28,29,30,31,33)/p+1 |
| InChIKey | JJWZQYRMDBLHSJ-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|