C20H28N5O3S+ — CID 10768223
N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)propanamide (PubChem CID 10768223) has the molecular formula C20H28N5O3S+ and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)propanamide.
| Compound Name | N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 10768223 |
| Molecular Formula | C20H28N5O3S+ |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)propanamide |
| SMILES | Cc1cc(C)[n+](CCC(=O)Nc2ccc(S(=O)(=O)N=C(N)N)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C20H27N5O3S/c1-13(2)18-12-14(3)11-15(4)25(18)10-9-19(26)23-16-5-7-17(8-6-16)29(27,28)24-20(21)22/h5-8,11-13H,9-10H2,1-4H3,(H4-,21,22,23,24,26)/p+1 |
| InChIKey | JYPNIDYAGHWFBU-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|