C29H30N5O3S+ — CID 10416531
N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2-ethyl-4,6-diphenylpyridin-1-ium-1-yl)propanamide (PubChem CID 10416531) has the molecular formula C29H30N5O3S+ and a molecular weight of 528.66 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2-ethyl-4,6-diphenylpyridin-1-ium-1-yl)propanamide.
| Compound Name | N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2-ethyl-4,6-diphenylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 10416531 |
| Molecular Formula | C29H30N5O3S+ |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | N-[4-(diaminomethylideneamino)sulfonylphenyl]-3-(2-ethyl-4,6-diphenylpyridin-1-ium-1-yl)propanamide |
| SMILES | CCc1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1CCC(=O)Nc1ccc(S(=O)(=O)N=C(N)N)cc1 |
| InChI | InChI=1S/C29H29N5O3S/c1-2-25-19-23(21-9-5-3-6-10-21)20-27(22-11-7-4-8-12-22)34(25)18-17-28(35)32-24-13-15-26(16-14-24)38(36,37)33-29(30)31/h3-16,19-20H,2,17-18H2,1H3,(H4-,30,31,32,33,35)/p+1 |
| InChIKey | DRKDFYPZUCAFNK-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|