C17H23ClN2O6S — CID 10764510
4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate (PubChem CID 10764510) has the molecular formula C17H23ClN2O6S and a molecular weight of 418.90 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate.
| Compound Name | 4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate |
|---|---|
| PubChem CID | 10764510 |
| Molecular Formula | C17H23ClN2O6S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate |
| SMILES | Cc1cc(C)[n+](Cc2ccc(S(N)(=O)=O)cc2)c(C(C)C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H23N2O2S.ClHO4/c1-12(2)17-10-13(3)9-14(4)19(17)11-15-5-7-16(8-6-15)22(18,20)21;2-1(3,4)5/h5-10,12H,11H2,1-4H3,(H2,18,20,21);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | PGSAJTVUXUIELS-UHFFFAOYSA-M |
| XLogP | -2.35 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|