C25H31ClN2O5S — CID 24995233
4-[2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]ethyl]benzenesulfonamide chlorate (PubChem CID 24995233) has the molecular formula C25H31ClN2O5S and a molecular weight of 507.05 g/mol. Its IUPAC name is 4-[2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]ethyl]benzenesulfonamide chlorate.
| Compound Name | 4-[2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]ethyl]benzenesulfonamide chlorate |
|---|---|
| PubChem CID | 24995233 |
| Molecular Formula | C25H31ClN2O5S |
| Molecular Weight | 507.05 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 4-[2-[4-phenyl-2,6-di(propan-2-yl)pyridin-1-ium-1-yl]ethyl]benzenesulfonamide chlorate |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)[n+]1CCc1ccc(S(N)(=O)=O)cc1.[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/C25H31N2O2S.ClO3/c1-18(2)24-16-22(21-8-6-5-7-9-21)17-25(19(3)4)27(24)15-14-20-10-12-23(13-11-20)30(26,28)29;2-1(3)4/h5-13,16-19H,14-15H2,1-4H3,(H2,26,28,29);/q+1;-1 |
| InChIKey | RLFBSPYJRMQVRC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.05 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|