C17H23ClN2O5S — CID 24993992
4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate (PubChem CID 24993992) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate.
| Compound Name | 4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate |
|---|---|
| PubChem CID | 24993992 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 4-[(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide chlorate |
| SMILES | Cc1cc(C)[n+](Cc2ccc(S(N)(=O)=O)cc2)c(C(C)C)c1.[O-][Cl+2]([O-])[O-] |
| InChI | InChI=1S/C17H23N2O2S.ClO3/c1-12(2)17-10-13(3)9-14(4)19(17)11-15-5-7-16(8-6-15)22(18,20)21;2-1(3)4/h5-10,12H,11H2,1-4H3,(H2,18,20,21);/q+1;-1 |
| InChIKey | HDBKIIIKRUGHAE-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|