C19H18N4O3S2 — CID 4168509
2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide (PubChem CID 4168509) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 4168509 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide |
| SMILES | Cc1cc(-c2ccccc2)nc(SCC(=O)Nc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-13-11-17(14-5-3-2-4-6-14)23-19(21-13)27-12-18(24)22-15-7-9-16(10-8-15)28(20,25)26/h2-11H,12H2,1H3,(H,22,24)(H2,20,25,26) |
| InChIKey | VAIYUZOSOXRWAW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |