C26H22ClN5O8S3 — CID 11479385
5-[[4-(4-methyl-2,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide perchlorate (PubChem CID 11479385) has the molecular formula C26H22ClN5O8S3 and a molecular weight of 664.14 g/mol. Its IUPAC name is 5-[[4-(4-methyl-2,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide perchlorate.
| Compound Name | 5-[[4-(4-methyl-2,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide perchlorate |
|---|---|
| PubChem CID | 11479385 |
| Molecular Formula | C26H22ClN5O8S3 |
| Molecular Weight | 664.14 g/mol |
| Exact Mass | 663.03 |
| IUPAC Name | 5-[[4-(4-methyl-2,6-diphenylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide perchlorate |
| SMILES | Cc1cc(-c2ccccc2)[n+](-c2ccc(S(=O)(=O)Nc3nnc(S(N)(=O)=O)s3)cc2)c(-c2ccccc2)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H22N5O4S3.ClHO4/c1-18-16-23(19-8-4-2-5-9-19)31(24(17-18)20-10-6-3-7-11-20)21-12-14-22(15-13-21)38(34,35)30-25-28-29-26(36-25)37(27,32)33;2-1(3,4)5/h2-17H,1H3,(H,28,30)(H2,27,32,33);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QNXHNYWATWZDKX-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 228.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.14 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|