C16H17N4O4S3+ — CID 100967625
5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonyl-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 100967625) has the molecular formula C16H17N4O4S3+ and a molecular weight of 425.54 g/mol. Its IUPAC name is 5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonyl-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 100967625 |
| Molecular Formula | C16H17N4O4S3+ |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 5-[4-(2,4,6-trimethylpyridin-1-ium-1-yl)phenyl]sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Cc1cc(C)[n+](-c2ccc(S(=O)(=O)c3nnc(S(N)(=O)=O)s3)cc2)c(C)c1 |
| InChI | InChI=1S/C16H17N4O4S3/c1-10-8-11(2)20(12(3)9-10)13-4-6-14(7-5-13)26(21,22)15-18-19-16(25-15)27(17,23)24/h4-9H,1-3H3,(H2,17,23,24)/q+1 |
| InChIKey | OGIBXZDVDALKJI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|