C8H6N4O6S3 — CID 100967622
5-(2-nitrophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 100967622) has the molecular formula C8H6N4O6S3 and a molecular weight of 350.36 g/mol. Its IUPAC name is 5-(2-nitrophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-(2-nitrophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 100967622 |
| Molecular Formula | C8H6N4O6S3 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 349.94 |
| IUPAC Name | 5-(2-nitrophenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(S(=O)(=O)c2ccccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C8H6N4O6S3/c9-21(17,18)8-11-10-7(19-8)20(15,16)6-4-2-1-3-5(6)12(13)14/h1-4H,(H2,9,17,18) |
| InChIKey | WIEYCLWSMSJTEN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 163.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|