C11H13N3O4S3 — CID 100967629
5-(2,4,6-trimethylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 100967629) has the molecular formula C11H13N3O4S3 and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-(2,4,6-trimethylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-(2,4,6-trimethylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 100967629 |
| Molecular Formula | C11H13N3O4S3 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 5-(2,4,6-trimethylphenyl)sulfonyl-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2nnc(S(N)(=O)=O)s2)c(C)c1 |
| InChI | InChI=1S/C11H13N3O4S3/c1-6-4-7(2)9(8(3)5-6)20(15,16)10-13-14-11(19-10)21(12,17)18/h4-5H,1-3H3,(H2,12,17,18) |
| InChIKey | MYYPHXGLQAEVRX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |