C24H26O5S2 — CID 19349207
2,4-bis[(2,4,6-trimethylphenyl)sulfonyl]phenol (PubChem CID 19349207) has the molecular formula C24H26O5S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2,4-bis[(2,4,6-trimethylphenyl)sulfonyl]phenol.
| Compound Name | 2,4-bis[(2,4,6-trimethylphenyl)sulfonyl]phenol |
|---|---|
| PubChem CID | 19349207 |
| Molecular Formula | C24H26O5S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2,4-bis[(2,4,6-trimethylphenyl)sulfonyl]phenol |
| SMILES | Cc1cc(C)c(S(=O)(=O)c2ccc(O)c(S(=O)(=O)c3c(C)cc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C24H26O5S2/c1-14-9-16(3)23(17(4)10-14)30(26,27)20-7-8-21(25)22(13-20)31(28,29)24-18(5)11-15(2)12-19(24)6/h7-13,25H,1-6H3 |
| InChIKey | JGCZCWDYYPQTAE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |