C15H16O4S — CID 101301893
3-(4-hydroxy-3-methylphenyl)sulfonyl-4,5-dimethylphenol (PubChem CID 101301893) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methylphenyl)sulfonyl-4,5-dimethylphenol.
| Compound Name | 3-(4-hydroxy-3-methylphenyl)sulfonyl-4,5-dimethylphenol |
|---|---|
| PubChem CID | 101301893 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-(4-hydroxy-3-methylphenyl)sulfonyl-4,5-dimethylphenol |
| SMILES | Cc1cc(S(=O)(=O)c2cc(O)cc(C)c2C)ccc1O |
| InChI | InChI=1S/C15H16O4S/c1-9-6-12(16)8-15(11(9)3)20(18,19)13-4-5-14(17)10(2)7-13/h4-8,16-17H,1-3H3 |
| InChIKey | LEXFJOUWVZPKTF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |