C16H18O4S — CID 101301971
2-(5-hydroxy-2,3-dimethylphenyl)sulfonyl-3,6-dimethylphenol (PubChem CID 101301971) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-(5-hydroxy-2,3-dimethylphenyl)sulfonyl-3,6-dimethylphenol.
| Compound Name | 2-(5-hydroxy-2,3-dimethylphenyl)sulfonyl-3,6-dimethylphenol |
|---|---|
| PubChem CID | 101301971 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-(5-hydroxy-2,3-dimethylphenyl)sulfonyl-3,6-dimethylphenol |
| SMILES | Cc1cc(O)cc(S(=O)(=O)c2c(C)ccc(C)c2O)c1C |
| InChI | InChI=1S/C16H18O4S/c1-9-5-6-10(2)16(15(9)18)21(19,20)14-8-13(17)7-11(3)12(14)4/h5-8,17-18H,1-4H3 |
| InChIKey | LBZCQJVHVLLETH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |