C22H22O5S2 — CID 19349285
2,4-bis[(2,4-dimethylphenyl)sulfonyl]phenol (PubChem CID 19349285) has the molecular formula C22H22O5S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2,4-bis[(2,4-dimethylphenyl)sulfonyl]phenol.
| Compound Name | 2,4-bis[(2,4-dimethylphenyl)sulfonyl]phenol |
|---|---|
| PubChem CID | 19349285 |
| Molecular Formula | C22H22O5S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2,4-bis[(2,4-dimethylphenyl)sulfonyl]phenol |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(O)c(S(=O)(=O)c3ccc(C)cc3C)c2)c(C)c1 |
| InChI | InChI=1S/C22H22O5S2/c1-14-5-9-20(16(3)11-14)28(24,25)18-7-8-19(23)22(13-18)29(26,27)21-10-6-15(2)12-17(21)4/h5-13,23H,1-4H3 |
| InChIKey | WBHGYLOWHAOBQM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |