About 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol
2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol (PubChem CID 139696732) has the molecular formula C25H28O5S2
and a molecular weight of 472.63 g/mol. Its IUPAC name is 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol.
Molecular Properties
| Compound Name | 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol |
| PubChem CID | 139696732 |
| Molecular Formula | C25H28O5S2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol |
| SMILES | Cc1ccc(S(=O)(=O)c2cc(S(=O)(=O)c3ccc(C)cc3C)c(C(C)C)cc2O)c(C)c1 |
| InChI | InChI=1S/C25H28O5S2/c1-15(2)20-13-21(26)25(32(29,30)23-10-8-17(4)12-19(23)6)14-24(20)31(27,28)22-9-7-16(3)11-18(22)5/h7-15,26H,1-6H3 |
| InChIKey | AFFRJCASLDNGOS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol?
The IUPAC name of 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol (CID 139696732) is 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol.
What is the SMILES notation for 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol?
The canonical SMILES for 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol is Cc1ccc(S(=O)(=O)c2cc(S(=O)(=O)c3ccc(C)cc3C)c(C(C)C)cc2O)c(C)c1.
What is the InChIKey of 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol?
The InChIKey is AFFRJCASLDNGOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28O5S2/c1-15(2)20-13-21(26)25(32(29,30)23-10-8-17(4)12-19(23)6)14-24(20)31(27,28)22-9-7-16(3)11-18(22)5/h7-15,26H,1-6H3.
What are the key properties of 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol?
2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol has a molecular weight of 472.63 g/mol, XLogP of 5.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis[(2,4-dimethylphenyl)sulfonyl]-5-propan-2-ylphenol is sourced from PubChem (CID 139696732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).