C17H19BF4NO3S- — CID 44888751
N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate (PubChem CID 44888751) has the molecular formula C17H19BF4NO3S- and a molecular weight of 404.21 g/mol. Its IUPAC name is N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate.
| Compound Name | N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate |
|---|---|
| PubChem CID | 44888751 |
| Molecular Formula | C17H19BF4NO3S- |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2c(C)cc(C)cc2C)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C17H19NO3S.BF4/c1-11-9-12(2)17(13(3)10-11)22(20,21)16-7-5-15(6-8-16)18-14(4)19;2-1(3,4)5/h5-10H,1-4H3,(H,18,19);/q;-1 |
| InChIKey | FQAZHQAJBIWHNB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|