About N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate
N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate (PubChem CID 44888751) has the molecular formula C17H19BF4NO3S-
and a molecular weight of 404.21 g/mol. Its IUPAC name is N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate.
Molecular Properties
| Compound Name | N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate |
| PubChem CID | 44888751 |
| Molecular Formula | C17H19BF4NO3S- |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2c(C)cc(C)cc2C)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C17H19NO3S.BF4/c1-11-9-12(2)17(13(3)10-11)22(20,21)16-7-5-15(6-8-16)18-14(4)19;2-1(3,4)5/h5-10H,1-4H3,(H,18,19);/q;-1 |
| InChIKey | FQAZHQAJBIWHNB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate?
The IUPAC name of N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate (CID 44888751) is N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate.
What is the SMILES notation for N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate?
The canonical SMILES for N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate is CC(=O)Nc1ccc(S(=O)(=O)c2c(C)cc(C)cc2C)cc1.F[B-](F)(F)F.
What is the InChIKey of N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate?
The InChIKey is FQAZHQAJBIWHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO3S.BF4/c1-11-9-12(2)17(13(3)10-11)22(20,21)16-7-5-15(6-8-16)18-14(4)19;2-1(3,4)5/h5-10H,1-4H3,(H,18,19);/q;-1.
What are the key properties of N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate?
N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate has a molecular weight of 404.21 g/mol, XLogP of 4.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,4,6-trimethylphenyl)sulfonylphenyl]acetamide tetrafluoroborate is sourced from PubChem (CID 44888751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).