C14H12FNO3S — CID 70364757
N-[4-(2-fluorophenyl)sulfonylphenyl]acetamide (PubChem CID 70364757) has the molecular formula C14H12FNO3S and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[4-(2-fluorophenyl)sulfonylphenyl]acetamide.
| Compound Name | N-[4-(2-fluorophenyl)sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 70364757 |
| Molecular Formula | C14H12FNO3S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-[4-(2-fluorophenyl)sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C14H12FNO3S/c1-10(17)16-11-6-8-12(9-7-11)20(18,19)14-5-3-2-4-13(14)15/h2-9H,1H3,(H,16,17) |
| InChIKey | DFMSXPCQSGPQCE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |