C18H22N5O4S3+ — CID 11261583
5-[[4-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 11261583) has the molecular formula C18H22N5O4S3+ and a molecular weight of 468.61 g/mol. Its IUPAC name is 5-[[4-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[[4-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 11261583 |
| Molecular Formula | C18H22N5O4S3+ |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 5-[[4-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | Cc1cc(C)[n+](-c2ccc(S(=O)(=O)Nc3nnc(S(N)(=O)=O)s3)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C18H22N5O4S3/c1-11(2)16-10-12(3)9-13(4)23(16)14-5-7-15(8-6-14)30(26,27)22-17-20-21-18(28-17)29(19,24)25/h5-11H,1-4H3,(H,20,22)(H2,19,24,25)/q+1 |
| InChIKey | PNGNVUOPWWBBSY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|