C14H8F5N5O6S4 — CID 10793062
5-[[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 10793062) has the molecular formula C14H8F5N5O6S4 and a molecular weight of 565.50 g/mol. Its IUPAC name is 5-[[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 10793062 |
| Molecular Formula | C14H8F5N5O6S4 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.93 |
| IUPAC Name | 5-[[4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]phenyl]sulfonylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NS(=O)(=O)c2ccc(NS(=O)(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)s1 |
| InChI | InChI=1S/C14H8F5N5O6S4/c15-7-8(16)10(18)12(11(19)9(7)17)34(29,30)23-5-1-3-6(4-2-5)33(27,28)24-13-21-22-14(31-13)32(20,25)26/h1-4,23H,(H,21,24)(H2,20,25,26) |
| InChIKey | XGTIAYLYSJBDIA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|